WAY-300176
Modify Date: 2025-10-24 19:26:54
WAY-300176 structure
|
Common Name | WAY-300176 | ||
|---|---|---|---|---|
| CAS Number | 330958-01-5 | Molecular Weight | 336.4 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 497.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H21FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.6±28.7 °C | |
Use of WAY-300176α-glucosidase inhibitors; block the protein-protein interactions between AF9/ENL and DOT1L, therefore inhibiting MLL-fusion protein associated leukemia; |
| Name | WAY-300176 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.4±45.0 °C at 760 mmHg |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.4 |
| Flash Point | 254.6±28.7 °C |
| Exact Mass | 336.163788 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | ZJUIKJDXRMNKLF-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1NC2c1ccc(F)cc1 |
| 11-(4-Fluorophenyl)-3,3-dimethyl-2,3,4,5,10,11-hexahydro-1H-dibenzo[b,e][1,4]diazepin-1-one |
| 1H-Dibenzo[b,e][1,4]diazepin-1-one, 11-(4-fluorophenyl)-2,3,4,5,10,11-hexahydro-3,3-dimethyl- |
| MFCD01210594 |