WAY-231547
Modify Date: 2024-04-07 12:17:13
WAY-231547 structure
|
Common Name | WAY-231547 | ||
|---|---|---|---|---|
| CAS Number | 328540-92-7 | Molecular Weight | 373.25 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H17BrN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-231547trypanothione reductase inhibitors; Trypanosoma brucei Trypanothione Reductase Inhibitors. |
| Name | WAY-231547 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H17BrN4O |
| Molecular Weight | 373.25 |
| Exact Mass | 372.058563 |
| LogP | 0.97 |
| Index of Refraction | 1.682 |
| InChIKey | DDSZTCDLYPIRAN-UHFFFAOYSA-N |
| SMILES | CC1=Nc2ccc(Br)cc2C(c2ccccc2)N1CC(=O)NN |
| 2-(6-Bromo-2-methyl-4-phenylquinazolin-3(4H)-yl)acetohydrazide |
| 3(4H)-Quinazolineacetic acid, 6-bromo-2-methyl-4-phenyl-, hydrazide |
| 2-(6-Bromo-2-methyl-4-phenyl-3(4H)-quinazolinyl)acetohydrazide |