BCDA structure
|
Common Name | BCDA | ||
|---|---|---|---|---|
| CAS Number | 3252-36-6 | Molecular Weight | 288.52500 | |
| Density | 1.721g/cm3 | Boiling Point | 429.3ºC at 760mmHg | |
| Molecular Formula | C10H7BrClNO2 | Melting Point | 107 °C(dec.) | |
| MSDS | Chinese USA | Flash Point | 213.4ºC | |
Use of BCDAEsterase chromogenic substrate-1 is a chromogenic substrate of esterase used to detect the activity of esterase. |
| Name | (5-bromo-4-chloro-1H-indol-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Esterase chromogenic substrate-1 is a chromogenic substrate of esterase used to detect the activity of esterase. |
|---|---|
| Related Catalog |
| Density | 1.721g/cm3 |
|---|---|
| Boiling Point | 429.3ºC at 760mmHg |
| Melting Point | 107 °C(dec.) |
| Molecular Formula | C10H7BrClNO2 |
| Molecular Weight | 288.52500 |
| Flash Point | 213.4ºC |
| Exact Mass | 286.93500 |
| PSA | 42.09000 |
| LogP | 3.50910 |
| Index of Refraction | 1.667 |
| InChIKey | WPWLFFMSSOAORQ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c[nH]c2ccc(Br)c(Cl)c12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
| HS Code | 2933990090 |
|
~%
BCDA CAS#:3252-36-6 |
| Literature: Pr.roy. Soc., , vol. 148, p. 481,491,493 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Studies in enzyme cytochemistry. V. An appraisal of indigogenic reactions for esterase localization.
Proc. Royal Soc. Lond. B. 148 , 520, (1958)
|
| BCDA |
| BIB1170 |
| 5-Bromo-4-chloro-3-indolyl acetate |
| Essigsaeure-(5-brom-4-chlor-indol-3-ylester) |
| 5-Bromo-4-chloroindoxyl acetate |
| acetic acid-(5-bromo-4-chloro-indol-3-yl ester) |
| MFCD00037932 |
| Esterase chromogenic substrate-1 |