1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate structure
|
Common Name | 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate | ||
|---|---|---|---|---|
| CAS Number | 3030-06-6 | Molecular Weight | 330.562 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 429.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H9BrClNO3 | Melting Point | 165-168 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 213.5±27.3 °C | |
| Name | (1-acetyl-5-bromo-4-chloroindol-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.5±40.0 °C at 760 mmHg |
| Melting Point | 165-168 °C(lit.) |
| Molecular Formula | C12H9BrClNO3 |
| Molecular Weight | 330.562 |
| Flash Point | 213.5±27.3 °C |
| Exact Mass | 328.945435 |
| PSA | 48.30000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | DSHQTSIXXYZXGR-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cn(C(C)=O)c2ccc(Br)c(Cl)c12 |
| Storage condition | −20°C |
| Stability | Moisture, Temperature, Light sensitive |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
1-Acetyl-5-brom... CAS#:3030-06-6 |
| Literature: Pr.roy. Soc., , vol. 148, p. 481,491,492 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Engineering transglycosidase activity into a GH51 α-l-arabinofuranosidase.
New Biotechnology 30(5) , 536-44, (2013) Directed evolution was applied to the α-l-arabinofuranosidase from Thermobacillus xylanilyticus to confer better transglycosylation ability, particularly for the synthesis of benzyl α-l-arabinofuranos... |
| 3-acetoxy-1-acetyl-5-bromo-4-chloroindole |
| Ethanone, 1-[3-(acetyloxy)-5-bromo-4-chloro-1H-indol-1-yl]- |
| 1H-Indol-3-ol, 1-acetyl-5-bromo-4-chloro-, acetate (ester) |
| 5-bromo-4-chloroindoxyl-1,3-diacetate |
| 3-Acetoxy-1-acetyl-5-brom-4-chlor-indol |
| 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate |
| EINECS 221-200-6 |
| 5-Bromo-4-chloro-3-indolyl 1,3-diacetate |
| MFCD00040632 |
| 1H-Indol-3-ol,1-acetyl-5-bromo-4-chloro-,acetate (ester) |