WAY-300091
Modify Date: 2025-10-03 12:45:12
WAY-300091 structure
|
Common Name | WAY-300091 | ||
|---|---|---|---|---|
| CAS Number | 317842-06-1 | Molecular Weight | 387.86 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 593.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H22ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.6±32.9 °C | |
Use of WAY-300091liver X receptor agonists |
| Name | WAY-300091 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 593.3±60.0 °C at 760 mmHg |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.86 |
| Flash Point | 312.6±32.9 °C |
| Exact Mass | 387.146210 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | UQNBHILYOOCSAE-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(nc(N3CCCCC3)n2Cc2ccccc2Cl)n(C)c1=O |
| 7-(2-Chlorobenzyl)-1,3-dimethyl-8-(1-piperidinyl)-3,7-dihydro-1H-purine-2,6-dione |
| 7-(2-chlorobenzyl)-1,3-dimethyl-8-(piperidin-1-yl)-3,7-dihydro-1H-purine-2,6-dione |
| MFCD00837029 |
| 1H-Purine-2,6-dione, 7-[(2-chlorophenyl)methyl]-3,7-dihydro-1,3-dimethyl-8-(1-piperidinyl)- |
| 7-(2-Chloro-benzyl)-1,3-dimethyl-8-piperidin-1-yl-3,7-dihydro-purine-2,6-dione |