WAY-320144
Modify Date: 2025-09-19 14:31:33
WAY-320144 structure
|
Common Name | WAY-320144 | ||
|---|---|---|---|---|
| CAS Number | 313275-18-2 | Molecular Weight | 403.43054 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-320144Antitumor histone acetyl transferase inhibitors; sirtuin modulators; sirtuin modulators; sirtuin modulators; sirtuin modulators; sirtuin modulators; |
| Name | WAY-320144 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.43054 |
| Exact Mass | 403.153198 |
| LogP | 4.78 |
| Index of Refraction | 1.667 |
| InChIKey | RNRJVBBDMLIESA-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Nc2ccccc2-c2nc3ccccc3[nH]2)cc(OC)c1OC |
| N-[2-(1H-Benzimidazol-2-yl)phenyl]-3,4,5-trimethoxybenzamide |
| Benzamide, N-[2-(1H-benzimidazol-2-yl)phenyl]-3,4,5-trimethoxy- |
| MFCD01932517 |