Glutaminase C-IN-1 structure
|
Common Name | Glutaminase C-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 311795-38-7 | Molecular Weight | 475.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H27BrN2O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Glutaminase C-IN-1Glutaminase C-IN-1 (968) is an allosteric inhibitor of Glutaminase C that inhibits cancer cell growth without affecting their normal cellular counterparts. |
| Name | 5-[3-bromo-4-(dimethylamino)phenyl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Glutaminase C-IN-1 (968) is an allosteric inhibitor of Glutaminase C that inhibits cancer cell growth without affecting their normal cellular counterparts. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H27BrN2O |
|---|---|
| Molecular Weight | 475.42000 |
| Exact Mass | 474.13100 |
| PSA | 32.34000 |
| LogP | 7.11580 |
| InChIKey | NVFRRJQWRZFDLM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)cc1Br |
| Storage condition | 2-8℃ |
| Hazard Statements | H413 |
|---|---|
| RIDADR | NONH for all modes of transport |
| QC-219 |
| 5-[3-bromo-4-(dimethylamino)phenyl]-2,2-dimethyl-2,3,5,6-tetrahydrobenzo[a]phenanthridin-4(1H)-one |
| Glutaminase C-IN-1 |