WAY-608248
Modify Date: 2024-04-05 18:21:48
WAY-608248 structure
|
Common Name | WAY-608248 | ||
|---|---|---|---|---|
| CAS Number | 308297-79-2 | Molecular Weight | 421.51 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 611.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C23H23N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.6±34.3 °C | |
Use of WAY-608248Skp2 inhibitor |
| Name | WAY-608248 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 611.5±65.0 °C at 760 mmHg |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.51 |
| Flash Point | 323.6±34.3 °C |
| Exact Mass | 421.146027 |
| LogP | 2.62 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | PBWPKUFFCSSKOM-UHFFFAOYSA-N |
| SMILES | Cc1oc2c(CN3CCN(C)CC3)c(O)ccc2c(=O)c1-c1nc2ccccc2s1 |
| 3-(1,3-Benzothiazol-2-yl)-7-hydroxy-2-methyl-8-[(4-methyl-1-piperazinyl)methyl]-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 3-(2-benzothiazolyl)-7-hydroxy-2-methyl-8-[(4-methyl-1-piperazinyl)methyl]- |
| 3-(1,3-benzothiazol-2-yl)-7-hydroxy-2-methyl-8-[(4-methylpiperazin-1-yl)methyl]-4H-chromen-4-one |
| MFCD01959056 |