WAY-359061
Modify Date: 2025-10-06 18:05:45
WAY-359061 structure
|
Common Name | WAY-359061 | ||
|---|---|---|---|---|
| CAS Number | 307509-59-7 | Molecular Weight | 304.79452 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H13ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-359061MicroRNA modulators; MicroRNA modulators; |
| Name | WAY-359061 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.79452 |
| Exact Mass | 304.043701 |
| LogP | 3.95 |
| Index of Refraction | 1.611 |
| InChIKey | WQMOWVGZKGIPPZ-BMWMMMPHSA-N |
| SMILES | O=C(Cc1cccs1)NN=CC(Cl)=Cc1ccccc1 |
| N'-[(1Z,2Z)-2-Chloro-3-phenylprop-2-en-1-ylidene]-2-(2-thienyl)acetohydrazide |
| 2-Thiopheneacetic acid, 2-[(1Z,2Z)-2-chloro-3-phenyl-2-propen-1-ylidene]hydrazide |
| N'-[(1Z,2Z)-2-Chloro-3-phenyl-2-propen-1-ylidene]-2-(2-thienyl)acetohydrazide |