2-(2,6-dioxopiperidin-4-yl)isoindole-1,3-dione structure
|
Common Name | 2-(2,6-dioxopiperidin-4-yl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 303-31-1 | Molecular Weight | 258.22900 | |
| Density | 1.503g/cm3 | Boiling Point | 509.7ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | 2-(2,6-dioxopiperidin-4-yl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 509.7ºC at 760 mmHg |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.22900 |
| Flash Point | 262.1ºC |
| Exact Mass | 258.06400 |
| PSA | 87.04000 |
| LogP | 0.30160 |
| Index of Refraction | 1.646 |
| InChIKey | GMEPAZUSFGASQZ-UHFFFAOYSA-N |
| SMILES | O=C1CC(N2C(=O)c3ccccc3C2=O)CC(=O)N1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| E 350 |
| 3-Phthalimido-glutarsaeureimid |
| CG 809 |
| 2,6-Dioxo-4-phthalimido-piperidin |
| 3-Phthalimido-glutarimid |
| 3-Phthalimidoglutarimide,DL |