1,1-Bis(tert-butylperoxy)cyclohexane structure
|
Common Name | 1,1-Bis(tert-butylperoxy)cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 3006-86-8 | Molecular Weight | 260.370 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 278.8±10.0 °C at 760 mmHg | |
| Molecular Formula | C14H28O4 | Melting Point | 65 °C (SADT) | |
| MSDS | USA | Flash Point | 97.3±18.9 °C | |
| Symbol |
GHS02, GHS07, GHS08 |
Signal Word | Danger | |
| Name | 1,1-Di(tert-butylperoxy)cyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.8±10.0 °C at 760 mmHg |
| Melting Point | 65 °C (SADT) |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.370 |
| Flash Point | 97.3±18.9 °C |
| Exact Mass | 260.198761 |
| PSA | 36.92000 |
| LogP | 5.39 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.450 |
| InChIKey | HSLFISVKRDQEBY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC1(OOC(C)(C)C)CCCCC1 |
| Storage condition | Refrigerator (+4°C) |
| Water Solubility | miscible |
| Symbol |
GHS02, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H242-H304-H315-H319-H332-H335-H340-H350 |
| Precautionary Statements | P201-P210-P234-P261-P280-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | O:Oxidizingagent; |
| Risk Phrases | R7 |
| Safety Phrases | S17-S36/37/39-S3/7-S14A-S61-S60-S45-S26-S14-S53 |
| RIDADR | UN 3103 5.2 |
| WGK Germany | 2 |
| Packaging Group | II |
| Hazard Class | 5.2 |
| HS Code | 2909600000 |
|
~91%
1,1-Bis(tert-bu... CAS#:3006-86-8 |
| Literature: Sugihara, Yasushi; Watanabe, Yasumasa; Kumura, Hiromi; Nakamura, Tomoyuki; Suyama, Shuji; Sawaki, Yasuhiko Bulletin of the Chemical Society of Japan, 1992 , vol. 65, # 3 p. 664 - 667 |
|
~91%
1,1-Bis(tert-bu... CAS#:3006-86-8 |
| Literature: Terent'ev, Alexander O.; Kutkin, Alexander V.; Troizky, Nikolay A.; Ogibin, Yuri N.; Nikishin, Gennady I. Synthesis, 2005 , # 13 art. no. P03005SS, p. 2215 - 2219 |
|
~90%
1,1-Bis(tert-bu... CAS#:3006-86-8 |
| Literature: Terent'ev, Alexander O.; Kutkin, Alexander V.; Troizky, Nikolay A.; Ogibin, Yuri N.; Nikishin, Gennady I. Synthesis, 2005 , # 13 art. no. P03005SS, p. 2215 - 2219 |
|
~%
1,1-Bis(tert-bu... CAS#:3006-86-8 |
| Literature: Doklady Chemistry, , vol. 311, # 4 p. 75 - 78 Dokl. Akad. Nauk SSSR Ser. Khim., , vol. 311, # 6 p. 1377 - 1381 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| MFCD00084800 |
| Chaloxyd P |
| 1,1-Bis(tert-butylperoxy)cyclohexane |
| Trigonox 22C50 |
| EINECS 221-111-2 |
| DP275B |
| Perhexa-C |
| 1,1-Bis[(2-methyl-2-propanyl)peroxy]cyclohexane |
| Luperox 331M80 |
| Trigonox 22 |
| Lupersol 331 |
| 1,1-di-tert-butylperoxycyclohexane |