1,1-Bis(t-butylperoxy)-3,3,5-trimethylcyclohexane structure
|
Common Name | 1,1-Bis(t-butylperoxy)-3,3,5-trimethylcyclohexane | ||
|---|---|---|---|---|
| CAS Number | 6731-36-8 | Molecular Weight | 302.449 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 312.2±12.0 °C at 760 mmHg | |
| Molecular Formula | C17H34O4 | Melting Point | -20 °C | |
| MSDS | Chinese USA | Flash Point | 108.7±19.4 °C | |
| Symbol |
GHS01, GHS02 |
Signal Word | Danger | |
| Name | 1,1-Di-(tert-butylperoxy)-3,3,5-trimethylcyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.2±12.0 °C at 760 mmHg |
| Melting Point | -20 °C |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.449 |
| Flash Point | 108.7±19.4 °C |
| Exact Mass | 302.245697 |
| PSA | 36.92000 |
| LogP | 6.91 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | NALFRYPTRXKZPN-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)CC(OOC(C)(C)C)(OOC(C)(C)C)C1 |
| Storage condition | Refrigerator (+4°C) |
| Water Solubility | immiscible |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS01, GHS02 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H241-H413 |
| Precautionary Statements | P220-P261-P280-P305 + P351 + P338-P410 + P412 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | O:Oxidizingagent; |
| Risk Phrases | R7 |
| Safety Phrases | S7-S17-S36/37/39-S3/7-S28B-S26-S14A-S14-S47-S61-S45-S53 |
| RIDADR | UN 3110 5.2 |
| WGK Germany | 3 |
| RTECS | SD8600000 |
| Packaging Group | II |
| Hazard Class | 5.2 |
| HS Code | 2909600000 |
|
~63%
1,1-Bis(t-butyl... CAS#:6731-36-8 |
| Literature: Ehrfeld Mikrotechnik BTS GmbH; Pergan Hilfsstoffe Fur Industrielle Prozesse GmbH Patent: US2009/43122 A1, 2009 ; Location in patent: Page/Page column 6 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Fabrication and characterization of DTBP-crosslinked chitosan scaffolds for skin tissue engineering.
Biomaterials 26(35) , 7241-50, (2005) Chitosan, the deacetylated derivative of chitin, is a promising scaffold material for skin tissue engineering applications. It is biocompatible and biodegradable, and the degradation products are reso... |
|
|
[Extraction-photometric analysis of low levels of hem-ditret-butylperoxy-3,3,5-trimethylcyclohexane peroxide in in water solutions].
Gig. Sanit. (8) , 90-1, (1990)
|
|
|
[13-week subchronic toxicity study of 1,1-bis(t-butylperoxy) 3,3,5-trimethyl cyclohexane in mice].
Eisei Shikenjo Hokoku. (110) , 42-8, (1992) A 13-week subchronic toxicity study of 1,1-bis(t-butylperoxy)3,3,5-trimethyl cyclohexane (TMCH) was performed in male and female B6C3F1 mice by feeding a CRF-1 powder diet containing 0, 0.5, 1.0, 2.0 ... |
| 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane |
| luperco231g |
| luperco231xl |
| MFCD00084801 |
| perhexa3m |
| lupersol231 |
| EINECS 229-782-3 |
| 1,1-di-tert.-butyl peroxy-3,3,5-trimethyl cyclohexane |
| trigonox 29 |
| 1,1,5-Trimethyl-3,3-bis[(2-methyl-2-propanyl)peroxy]cyclohexane |
| TMCH |
| LUPEROX 231 |
| VAROX 231 |
| perhexa3m40 |