WAY-112273
Modify Date: 2025-08-25 12:24:08
WAY-112273 structure
|
Common Name | WAY-112273 | ||
|---|---|---|---|---|
| CAS Number | 294656-32-9 | Molecular Weight | 308.33 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 731.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.0±32.9 °C | |
Use of WAY-112273glutathione peroxidase inhibitor |
| Name | WAY-112273 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 731.2±60.0 °C at 760 mmHg |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.33 |
| Flash Point | 396.0±32.9 °C |
| Exact Mass | 308.127319 |
| LogP | 1.11 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.805 |
| InChIKey | BRAVWGDNMCOQTD-UHFFFAOYSA-N |
| SMILES | OCc1nc2ccc(Cc3ccc4nc(CO)[nH]c4c3)cc2[nH]1 |
| [Methylenebis(1H-benzimidazole-6,2-diyl)]dimethanol |
| 1H-Benzimidazole-2-methanol, 6,6'-methylenebis- |