WAY-299771 structure
|
Common Name | WAY-299771 | ||
|---|---|---|---|---|
| CAS Number | 290835-37-9 | Molecular Weight | 338.38 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 556.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.6±32.9 °C | |
Use of WAY-299771inhibit the dephosphorylation activity of PTPsigma; GEF Inhibitor; |
| Name | WAY-299771 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 556.9±60.0 °C at 760 mmHg |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.38 |
| Flash Point | 290.6±32.9 °C |
| Exact Mass | 338.072510 |
| LogP | 4.76 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | INXMUTHYYBNJJD-YBEGLDIGSA-N |
| SMILES | COc1ccc(C=c2sc3nc4ccccc4n3c2=O)cc1OC |
| (2E)-2-(3,4-Dimethoxybenzylidene)[1,3]thiazolo[3,2-a]benzimidazol-3(2H)-one |
| MFCD00390899 |
| Thiazolo[3,2-a]benzimidazol-3(2H)-one, 2-[(3,4-dimethoxyphenyl)methylene]-, (2E)- |