Imnopitant
Modify Date: 2025-09-02 17:23:41
Imnopitant structure
|
Common Name | Imnopitant | ||
|---|---|---|---|---|
| CAS Number | 290297-57-3 | Molecular Weight | 550.54 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 606.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H28F6N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.6±31.5 °C | |
Use of ImnopitantImnopitant is a NK1 receptor antagonist (WO2020132716, compound 1) [1]. |
| Name | N-[3,5-Bis(trifluoromethyl)benzyl]-N-methyl-4-(2-methylphenyl)-6-(4-methyl-1-piperazinyl)nicotinamide |
|---|---|
| Synonym | More Synonyms |
| Description | Imnopitant is a NK1 receptor antagonist (WO2020132716, compound 1) [1]. |
|---|---|
| Related Catalog | |
| Target |
NK1 |
| In Vitro | Imnopitant is a NK1 receptor antagonist[1]. |
| References |
[1]. WO2020132716 |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 606.5±55.0 °C at 760 mmHg |
| Molecular Formula | C28H28F6N4O |
| Molecular Weight | 550.54 |
| Flash Point | 320.6±31.5 °C |
| Exact Mass | 550.216736 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | HCNNJLLLMSVTFH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1cc(N2CCN(C)CC2)ncc1C(=O)N(C)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| 3-Pyridinecarboxamide, N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-4-(2-methylphenyl)-6-(4-methyl-1-piperazinyl)- |
| N-[3,5-Bis(trifluoromethyl)benzyl]-N-methyl-4-(2-methylphenyl)-6-(4-methyl-1-piperazinyl)nicotinamide |
| N-[3,5-bis(trifluoromethyl)benzyl]-N-methyl-4-(2-methylphenyl)-6-(4-methylpiperazin-1-yl)pyridine-3-carboxamide |