α-Linolenic acid-13C18 structure
|
Common Name | α-Linolenic acid-13C18 | ||
|---|---|---|---|---|
| CAS Number | 287111-28-8 | Molecular Weight | 296.29700 | |
| Density | 0.971 g/mLat 25 °C | Boiling Point | N/A | |
| Molecular Formula | 13C18H30O2 | Melting Point | -11 °C | |
| MSDS | N/A | Flash Point | 113 °C | |
Use of α-Linolenic acid-13C18α-Linolenic acid-13C18 is the 13C labeled α-Linolenic acid. α-Linolenic acid, isolated from seed oils, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer[1]. |
| Name | (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | α-Linolenic acid-13C18 is the 13C labeled α-Linolenic acid. α-Linolenic acid, isolated from seed oils, is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 0.971 g/mLat 25 °C |
|---|---|
| Melting Point | -11 °C |
| Molecular Formula | 13C18H30O2 |
| Molecular Weight | 296.29700 |
| Flash Point | 113 °C |
| Exact Mass | 296.28500 |
| PSA | 37.30000 |
| LogP | 5.66050 |
| InChIKey | DTOSIQBPPRVQHS-JHNAZIRYSA-N |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)O |
| Storage condition | -20°C |
| cis-| currency9,12,15-Octadecatrienoic Acid-13C18 |
| |A-Linolenic Acid-13C18 |
| Linolenic Acid-13C18 |
| 9,12,15-all-cis-Octadecatrienoic Acid-13C18 |
| all-cis-9,12,15-Octadecatrienoic Acid-13C18 |