Euphorbiasteroid structure
|
Common Name | Euphorbiasteroid | ||
|---|---|---|---|---|
| CAS Number | 28649-59-4 | Molecular Weight | 552.655 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 633.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C32H40O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9±31.5 °C | |
Use of EuphorbiasteroidEuphorbiasteroid is a tricyclic diperpene of Euphorbia lathyris L., inhibits tyrosinase, and increases the phosphorylation of AMPK, with anti-cancer, anti-virus, anti-obesity and multidrug resistance-modulating effect[1]. |
| Name | euphorbiasteroid(p) |
|---|---|
| Synonym | More Synonyms |
| Description | Euphorbiasteroid is a tricyclic diperpene of Euphorbia lathyris L., inhibits tyrosinase, and increases the phosphorylation of AMPK, with anti-cancer, anti-virus, anti-obesity and multidrug resistance-modulating effect[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 633.1±55.0 °C at 760 mmHg |
| Molecular Formula | C32H40O8 |
| Molecular Weight | 552.655 |
| Flash Point | 263.9±31.5 °C |
| Exact Mass | 552.272339 |
| PSA | 108.50000 |
| LogP | 5.55 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | SDGDWRYYHQOQOJ-CEZCSSGASA-N |
| SMILES | CC(=O)OC1C2C(OC(=O)Cc3ccccc3)C(C)CC2(OC(C)=O)C(=O)C(C)=CC2C(CCC13CO3)C2(C)C |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 29061990 |
| Epoxylathyrol |
| euphorbiasteroid |
| Benzeneacetic acid, (1aR,4aR,6S,7S,7aR,8S,9R,11aS)-4a,8-bis(acetyloxy)-1,1a,4,4a,5,6,7,7a,8,10,11,11a-dodecahydro-1,1,3,6-tetramethyl-4-oxospiro[9H-cyclopenta[a]cyclopropa[f]cycloundecene-9,2'-oxiran]-7-yl ester |
| Benzeneacetic acid, (1aR,2E,4aR,6S,7S,7aR,8S,9R,11aS)-4a,8-bis(acetyloxy)-1,1a,4,4a,5,6,7,7a,8,10,11,11a-dodecahydro-1,1,3,6-tetramethyl-4-oxospiro[9H-cyclopenta[a]cyclopropa[f]cycloundecene-9,2'-oxiran]-7-yl ester |
| 6,20-Epoxylathyrol-5,10-diacetat-3-phenylacetat |
| (1aR,4aR,6S,7S,7aR,8S,9R,11aS)-4a,8-Diacetoxy-1,1,3,6-tetramethyl-4-oxo-1,1a,4,4a,5,6,7,7a,8,10,11,11a-dodecahydrospiro[cyclopenta[a]cyclopropa[f][11]annulene-9,2'-oxiran]-7-yl phenylacetate |
| (1aR,2E,4aR,6S,7S,7aR,8S,9R,11aS)-4a,8-Diacetoxy-1,1,3,6-tetramethyl-4-oxo-1,1a,4,4a,5,6,7,7a,8,10,11,11a-dodecahydrospiro[cyclopenta[a]cyclopropa[f][11]annulene-9,2'-oxiran]-7-yl phenylacetate |
| 1,10-epoxyaristolane |