INY-03-041
Modify Date: 2025-12-01 12:37:28
INY-03-041 structure
|
Common Name | INY-03-041 | ||
|---|---|---|---|---|
| CAS Number | 2503017-97-6 | Molecular Weight | 789.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H56ClN7O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | INY-03-041 |
|---|
| Molecular Formula | C44H56ClN7O5 |
|---|---|
| Molecular Weight | 789.41 |
| InChIKey | GQGZWBDNMCIYSF-OZDCPDTESA-N |
| SMILES | CC1CC(O)c2ncnc(N3CCN(C(=O)C(CNCCCCCCCCCCc4cccc5c4CN(C4CCC(=O)NC4=O)C5=O)c4ccc(Cl)cc4)CC3)c21 |
| Water Solubility | DMSO : 115 mg/mL (144.04 mM; ultrasonic and warming and heat to 80°C) |
| Hazard Codes | Xi |
|---|