Dexrazoxane structure
|
Common Name | Dexrazoxane | ||
|---|---|---|---|---|
| CAS Number | 24584-09-6 | Molecular Weight | 268.269 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 531.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C11H16N4O4 | Melting Point | 194-196ºC | |
| MSDS | Chinese USA | Flash Point | 275.3±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of DexrazoxaneDexrazoxane(ICRF187) is a cardioprotective agent.Target: OthersDexrazoxane is a cardioprotective agent. Dexrazoxane is a derivative of EDTA, dexrazoxane chelates iron and thus reduces the number of metal ions complexed with anthracycline and, consequently, decrease the formation of superoxide radicals. The exact chelation mechanism is unknown, but it has be postulated that dexrazoxane can be converted into ring-opened form intracellularly and interfere with iron-mediated free radical generation that is in part thought to be responsible for anthryacycline induced cadiomyopathy. It was speculated that dexrazoxane could be used for further investigation to synthesize new antimalarial drugs [1, 2]. |
| Name | (+)-dexrazoxane |
|---|---|
| Synonym | More Synonyms |
| Description | Dexrazoxane(ICRF187) is a cardioprotective agent.Target: OthersDexrazoxane is a cardioprotective agent. Dexrazoxane is a derivative of EDTA, dexrazoxane chelates iron and thus reduces the number of metal ions complexed with anthracycline and, consequently, decrease the formation of superoxide radicals. The exact chelation mechanism is unknown, but it has be postulated that dexrazoxane can be converted into ring-opened form intracellularly and interfere with iron-mediated free radical generation that is in part thought to be responsible for anthryacycline induced cadiomyopathy. It was speculated that dexrazoxane could be used for further investigation to synthesize new antimalarial drugs [1, 2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.5±50.0 °C at 760 mmHg |
| Melting Point | 194-196ºC |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.269 |
| Flash Point | 275.3±30.1 °C |
| Exact Mass | 268.117157 |
| PSA | 98.82000 |
| LogP | -0.37 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | BMKDZUISNHGIBY-ZETCQYMHSA-N |
| SMILES | CC(CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| Storage condition | Desiccate at RT |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933599090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Translational downregulation of HSP90 expression by iron chelators in neuroblastoma cells.
Mol. Pharmacol. 87(3) , 513-24, (2015) Iron is an essential cellular nutrient, being a critical cofactor of several proteins involved in cell growth and replication. Compared with normal cells, neoplastic cells have been shown to require a... |
|
|
Doxorubicin impairs the insulin-like growth factor-1 system and causes insulin-like growth factor-1 resistance in cardiomyocytes.
PLoS ONE 10 , e0124643, (2015) Insulin-like growth factor-1 (IGF-1) promotes the survival of cardiomyocytes by activating type 1 IGF receptor (IGF-1R). Within the myocardium, IGF-1 action is modulated by IGF binding protein-3 (IGFB... |
|
|
Myocardial creatine levels do not influence response to acute oxidative stress in isolated perfused heart.
PLoS ONE 9(10) , e109021, (2014) Multiple studies suggest creatine mediates anti-oxidant activity in addition to its established role in cellular energy metabolism. The functional significance for the heart has yet to be established,... |
| 4-[(2S)-2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione |
| (+)-4,4'-(1-Methyl-1,2-ethanediyl)bis-2,6-piperazinedione |
| 2,6-Piperazinedione, 4,4'-[(1S)-1-methyl-1,2-ethanediyl]bis- |
| 4,4'-(2S)-Propan-1,2-diyldipiperazin-2,6-dion |
| 4,4'-[(2S)-1,2-Propanediyl]di(2,6-piperazinedione) |
| (+)-4,4'-Propylenedi-2,6-piperazinedione |
| Dexrazoxane |
| Desrazoxane |
| Razoxane (+)-form |
| (S)-1,2-Bis(3,5-dioxo-1-piperazinyl)propane |
| 4,4'-(2S)-Propane-1,2-diyldipiperazine-2,6-dione |
| Eucardion |
| MFCD00866449 |
| (+)-dexrazoxane |
| 4,4'-(2S)-propane-1,2-diyldipipérazine-2,6-dione |
| (s)-4,4'-(1-methyl-1,2-ethanediyl)bis-2,6-piperazinedione |