5,5'-Propane-2,2-diyldibiphenyl-2-ol structure
|
Common Name | 5,5'-Propane-2,2-diyldibiphenyl-2-ol | ||
|---|---|---|---|---|
| CAS Number | 24038-68-4 | Molecular Weight | 380.478 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 567.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H24O2 | Melting Point | 98-99ºC | |
| MSDS | N/A | Flash Point | 252.8±24.7 °C | |
Use of 5,5'-Propane-2,2-diyldibiphenyl-2-ol2,2-Bis(3-phenyl-4-hydroxyphenyl)propane (BisOPP-A) is a bioactive chemical, and can be used for the synthesis of active compound[1]. |
| Name | 4-[2-(4-hydroxy-3-phenylphenyl)propan-2-yl]-2-phenylphenol |
|---|---|
| Synonym | More Synonyms |
| Description | 2,2-Bis(3-phenyl-4-hydroxyphenyl)propane (BisOPP-A) is a bioactive chemical, and can be used for the synthesis of active compound[1]. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.4±50.0 °C at 760 mmHg |
| Melting Point | 98-99ºC |
| Molecular Formula | C27H24O2 |
| Molecular Weight | 380.478 |
| Flash Point | 252.8±24.7 °C |
| Exact Mass | 380.177643 |
| PSA | 40.46000 |
| LogP | 6.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | BKTRENAPTCBBFA-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)c(-c2ccccc2)c1)c1ccc(O)c(-c2ccccc2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2907199090 |
|
~40%
5,5'-Propane-2,... CAS#:24038-68-4 |
| Literature: Idemitsu Kosan Co., Ltd. Patent: US5151531 A1, 1992 ; |
|
~42%
5,5'-Propane-2,... CAS#:24038-68-4 |
| Literature: Hung; Werbel European Journal of Medicinal Chemistry, 1983 , vol. 18, # 1 p. 61 - 66 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,5'-Isopropylidenebis(2-hydroxybiphenyl) |
| 2,2-bis(4-hydroxy-3-phenyl-phenyl)propane |
| 2-bis(4-hydroxy-3-phenylphenyl)propane |
| 4,4'-isopropylidenebis(2-phenyl phenol) |
| 5,5'-(1-methylethylidene)bis[1,1'-(bisphenyl)-2-ol] |
| 5,5''-(1-methylethylidene)bis<<1,1'-biphenyl>-2-ol> |
| 5,5'-Propane-2,2-diyldibiphenyl-2-ol |
| 2,2-BIS(2-HYDROXY-5-BIPHENYLYL)PROPANE |
| 4,4'-Isopropylidenebis(2-phenylphenol) |
| 2,2-bis-(3-phenyl-4-hydroxyphenyl)propane |
| [1,1'-Biphenyl]-2-ol, 5,5'-(1-methylethylidene)bis- |
| 5,5'-(2,2-Propanediyl)di(2-biphenylol) |
| 5,5''-(Propane-2,2-diyl)bis(([1,1'-biphenyl]-2-ol)) |