thiamphenicol
Modify Date: 2025-08-25 12:46:59
thiamphenicol structure
|
Common Name | thiamphenicol | ||
|---|---|---|---|---|
| CAS Number | 2393-92-2 | Molecular Weight | 413.27400 | |
| Density | 1.468g/cm3 | Boiling Point | 672.5ºC at 760mmHg | |
| Molecular Formula | C14H18Cl2N2O6S | Melting Point | 163-166ºC | |
| MSDS | N/A | Flash Point | 360.5ºC | |
Use of thiamphenicolThiamphenicol glycinate, an alpha-amino acid ester, is a prodrug of Thiamphenicol (HY-B0479)[1]. |
| Name | [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Thiamphenicol glycinate, an alpha-amino acid ester, is a prodrug of Thiamphenicol (HY-B0479)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 672.5ºC at 760mmHg |
| Melting Point | 163-166ºC |
| Molecular Formula | C14H18Cl2N2O6S |
| Molecular Weight | 413.27400 |
| Flash Point | 360.5ºC |
| Exact Mass | 412.02600 |
| PSA | 144.17000 |
| LogP | 2.08590 |
| InChIKey | AMGKHLVPQHMHGQ-ZYHUDNBSSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(O)C(COC(=O)CN)NC(=O)C(Cl)Cl)cc1 |
| Storage condition | 0-6°C |
| Water Solubility | ethanol: 50 mg/mL, clear, colorless |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 2 |
| RTECS | AB6680000 |
| Thiamphenicol glycinate |
| (2r,3r)-2-[(dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate |
| HMS2090E09 |