Thiamphenicol Impurity 1
Modify Date: 2024-01-02 19:47:37
Thiamphenicol Impurity 1 structure
|
Common Name | Thiamphenicol Impurity 1 | ||
|---|---|---|---|---|
| CAS Number | 51458-28-7 | Molecular Weight | 245.29500 | |
| Density | 1.36g/cm3 | Boiling Point | 533.8ºC at 760mmHg | |
| Molecular Formula | C10H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.6ºC | |
| Name | (1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 533.8ºC at 760mmHg |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.29500 |
| Flash Point | 276.6ºC |
| Exact Mass | 245.07200 |
| PSA | 109.00000 |
| LogP | 1.22420 |
| Index of Refraction | 1.588 |
| InChIKey | CIAZEFCFQFQJLB-NXEZZACHSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(O)C(N)CO)cc1 |
| HS Code | 2922199090 |
|---|
CAS#:73231-34-2
CAS#:15318-45-3![(4S,5R)-4-(Fluoromethyl)-4,5-dihydro-5-[4-(methylsulfonyl)phenyl]-2-phenyloxazole structure](https://image.chemsrc.com/caspic/062/126428-97-5.png)
CAS#:126428-97-5![[(4R,5R)-5-(4-methylsulfonylphenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol structure](https://image.chemsrc.com/caspic/283/96795-00-5.png)
CAS#:96795-00-5| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 257-216-5 |
| (R(R*,R*))-2-Amino-1-(p-(methylsulphonyl)phenyl)propane-1,3-diol |
| [R(R*,R*]-2-Amino-1-[4-(Methylsulphonyl)Phenyl]Propane-1,3-Diol |
| Thiamphenicol Impurity 1 |