N-[2-(Diethylamino)ethyl]-N-octyl-2-pyridinamine structure
|
Common Name | N-[2-(Diethylamino)ethyl]-N-octyl-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 23846-00-6 | Molecular Weight | 305.50100 | |
| Density | 0.937g/cm3 | Boiling Point | 407.1ºC at 760 mmHg | |
| Molecular Formula | C19H35N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | N,N-diethyl-N'-octyl-N'-pyridin-2-ylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.937g/cm3 |
|---|---|
| Boiling Point | 407.1ºC at 760 mmHg |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.50100 |
| Flash Point | 200ºC |
| Exact Mass | 305.28300 |
| PSA | 19.37000 |
| LogP | 4.59030 |
| Vapour Pressure | 7.73E-07mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | MVTPMRASRXORIX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(CCN(CC)CC)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(N-(2-Diethylaminoethyl)-N-octylamino)pyridine |
| R.556 |
| Pyridine,2-(N-(2-diethylaminoethyl)-N-octylamino) |
| n,n-diethyl-n'-octyl-n'-(pyridin-2-yl)ethane-1,2-diamine |