N-[2-(Diethylamino)ethyl]-N-[3-(dimethylamino)propyl]-2-pyridinamine structure
|
Common Name | N-[2-(Diethylamino)ethyl]-N-[3-(dimethylamino)propyl]-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 23826-84-8 | Molecular Weight | 278.43600 | |
| Density | 0.981g/cm3 | Boiling Point | 380.2ºC at 760mmHg | |
| Molecular Formula | C16H30N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | N-[2-(Diethylamino)ethyl]-N',N'-dimethyl-N-(2-pyridinyl)-1,3-prop anediamine |
|---|
| Density | 0.981g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760mmHg |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.43600 |
| Flash Point | 183.7ºC |
| Exact Mass | 278.24700 |
| PSA | 22.61000 |
| LogP | 2.18150 |
| Vapour Pressure | 5.54E-06mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | HHQQNXLQFWSOIL-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN(CCCN(C)C)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |