N-[2-(Diethylamino)ethyl]-N-pentyl-4-methyl-2-pyridinamine structure
|
Common Name | N-[2-(Diethylamino)ethyl]-N-pentyl-4-methyl-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 23826-77-9 | Molecular Weight | 277.44800 | |
| Density | 0.947g/cm3 | Boiling Point | 388.8ºC at 760mmHg | |
| Molecular Formula | C17H31N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | N,N-diethyl-N'-(4-methylpyridin-2-yl)-N'-pentylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.947g/cm3 |
|---|---|
| Boiling Point | 388.8ºC at 760mmHg |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.44800 |
| Flash Point | 188.9ºC |
| Exact Mass | 277.25200 |
| PSA | 19.37000 |
| LogP | 3.72840 |
| Vapour Pressure | 2.99E-06mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | LALZXPQZLSFVOV-UHFFFAOYSA-N |
| SMILES | CCCCCN(CCN(CC)CC)c1cc(C)ccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(N-(2-Diethylaminoethyl)-N-pentylamino)-4-methylpyridine |
| Pyridine,2-(N-(2-diethylaminoethyl)-N-pentylamino)-4-methyl |
| R.666 |