N-[2-(Diethylamino)ethyl]-N-(2,6-dimethylphenyl)-2-butenamide structure
|
Common Name | N-[2-(Diethylamino)ethyl]-N-(2,6-dimethylphenyl)-2-butenamide | ||
|---|---|---|---|---|
| CAS Number | 20682-53-5 | Molecular Weight | 288.42800 | |
| Density | 0.994g/cm3 | Boiling Point | 377.3ºC at 760 mmHg | |
| Molecular Formula | C18H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136ºC | |
| Name | (E)-N-[2-(diethylamino)ethyl]-N-(2,6-dimethylphenyl)but-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.994g/cm3 |
|---|---|
| Boiling Point | 377.3ºC at 760 mmHg |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.42800 |
| Flash Point | 136ºC |
| Exact Mass | 288.22000 |
| PSA | 23.55000 |
| LogP | 3.55430 |
| Vapour Pressure | 6.82E-06mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | BELXZWITAIGKBF-UHFFFAOYSA-N |
| SMILES | CC=CC(=O)N(CCN(CC)CC)c1c(C)cccc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| sa 119 |