KB02-SLF
Modify Date: 2025-08-25 12:03:37
KB02-SLF structure
|
Common Name | KB02-SLF | ||
|---|---|---|---|---|
| CAS Number | 2384184-40-9 | Molecular Weight | 949.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H65ClN4O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KB02-SLFKB02-SLF is a PROTAC-based nuclear FKBP12 degrader (molecular glue). KB02-SLF promotes nuclear FKBP12 degradation by covalently modifying DCAF16 (E3 ligase) and can improve the durability of protein degradation in biological systems. SLF binds ubiquitin E3 ligase ligand KB02 via a linker to form KB02-SLF. |
| Name | KB02-SLF |
|---|
| Description | KB02-SLF is a PROTAC-based nuclear FKBP12 degrader (molecular glue). KB02-SLF promotes nuclear FKBP12 degradation by covalently modifying DCAF16 (E3 ligase) and can improve the durability of protein degradation in biological systems. SLF binds ubiquitin E3 ligase ligand KB02 via a linker to form KB02-SLF. |
|---|
| Molecular Formula | C50H65ClN4O12 |
|---|---|
| Molecular Weight | 949.52 |
| InChIKey | OKJBKEQXKMMRPL-WVILEFPPSA-N |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OC(CCc1ccc(OC)c(OC)c1)c1cccc(NC(=O)CCOCCOCCNC(=O)COc2ccc3c(c2)CCCN3C(=O)CCl)c1 |
| Hazard Codes | Xi |
|---|