Physcion 8-O-beta-D-monoglucoside structure
|
Common Name | Physcion 8-O-beta-D-monoglucoside | ||
|---|---|---|---|---|
| CAS Number | 23451-01-6 | Molecular Weight | 446.40408 | |
| Density | N/A | Boiling Point | 796.3±60.0 °C(Predicted) | |
| Molecular Formula | C22H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Physcion 8-O-beta-D-monoglucosidePhyscion 8-O-β-D-glucopyranosideis an anthraquinone compound isolated from Rumex japonicus Houtt. Physcion 8-O-β-D-glucopyranoside exerts anti-inflammatory and anti-cancer properties, can be for common malignancy cancer research[1]. |
| Name | Physcion 8-β-D-glucoside |
|---|---|
| Synonym | More Synonyms |
| Description | Physcion 8-O-β-D-glucopyranosideis an anthraquinone compound isolated from Rumex japonicus Houtt. Physcion 8-O-β-D-glucopyranoside exerts anti-inflammatory and anti-cancer properties, can be for common malignancy cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 796.3±60.0 °C(Predicted) |
|---|---|
| Molecular Formula | C22H22O10 |
| Molecular Weight | 446.40408 |
| InChIKey | POMKXWCJRHNLRP-DQMLXFRHSA-N |
| SMILES | COc1cc(OC2OC(CO)C(O)C(O)C2O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| Hazard Codes | Xi |
|---|
| 9,10-Anthracenedione, 1-(β-D-glucopyranosyloxy)-8-hydroxy-3-methoxy-6-methyl- |
| Physcion-8-O-β-D-glucoside |