Ethanone,1-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)- structure
|
Common Name | Ethanone,1-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 23121-32-6 | Molecular Weight | 210.22600 | |
| Density | 1.144g/cm3 | Boiling Point | 362.4ºC at 760mmHg | |
| Molecular Formula | C11H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.5ºC | |
Use of Ethanone,1-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)-Methylxanthoxylin is a ketone that can be isolated from the leaves and bark of Acradenia Jianklinii.[1]. |
| Name | 1-(2-hydroxy-4,6-dimethoxy-3-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Methylxanthoxylin is a ketone that can be isolated from the leaves and bark of Acradenia Jianklinii.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760mmHg |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.22600 |
| Flash Point | 140.5ºC |
| Exact Mass | 210.08900 |
| PSA | 55.76000 |
| LogP | 1.92040 |
| Vapour Pressure | 9.26E-06mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | AAOFJKLTRKOQTQ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C(C)=O)c(O)c1C |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (4',6'-Dimethoxy-2'-hydroxy-3'-methylphenyl) ethanone |
| 4,6-dimethoxy-2-hydroxy-3-methylacetophenone |
| 2,4-dimethoxy-6-hydroxy-5-C-methylacetophenone |
| 3,4,6-trimethylphloracetophenone |
| 1-(2-Hydroxy-4,6-dimethoxy-3-methyl-phenyl)-aethanon |
| 1-(2-hydroxy-4,6-dimethoxy-3-methyl-phenyl)-ethanone |