Danshensu lactic acid
Modify Date: 2025-08-27 05:35:06
Danshensu lactic acid structure
|
Common Name | Danshensu lactic acid | ||
|---|---|---|---|---|
| CAS Number | 23028-17-3 | Molecular Weight | 198.17300 | |
| Density | 1.54g/cm3 | Boiling Point | 480.3ºC at 760mmHg | |
| Molecular Formula | C9H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
Use of Danshensu lactic acid(Rac)-Salvianic acid A ((Rac)-Danshensu), a phenolic acids, is an efficient radical scavenger and antioxidant[1]. |
| Name | 3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (Rac)-Salvianic acid A ((Rac)-Danshensu), a phenolic acids, is an efficient radical scavenger and antioxidant[1]. |
|---|---|
| Related Catalog | |
| In Vitro | (Rac)-Salvianic acid A ((Rac)-Danshensu) exhibits higher scavenging activities against free hydroxyl radicals (HO), superoxide anion radicals (O2), 1,1-diphenyl-2-picryl-hydrazyl (DPPH) radicals and 2-azino-bis(3-ethylbenzthiazoline-6-sulfonic acid) (ABTS) radicals than vitamin C[1]. |
| In Vivo | (Rac)-Salvianic acid A ((Rac)-Danshensu; i.v.; 30 mg/kg) has a T1/2 of 16.6 min in rabbits[2]. |
| References |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 480.3ºC at 760mmHg |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17300 |
| Flash Point | 258.4ºC |
| Exact Mass | 198.05300 |
| PSA | 97.99000 |
| LogP | 0.08580 |
| InChIKey | PAFLSMZLRSPALU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)Cc1ccc(O)c(O)c1 |
| Water Solubility | Freely soluble (285 g/L) (25 ºC) |
| HS Code | 2918290000 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:20283-92-5| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| salvianic acid A |
| salvianic acid |
| a-Hydroxyhydrocaffeic acid |
| Danshensu lactic acid |
| alpha,3,4-Trihydroxy-benzenepropanoic acid |