2-Acetoxy-N,N,N-trimethylethanaminium iodide structure
|
Common Name | 2-Acetoxy-N,N,N-trimethylethanaminium iodide | ||
|---|---|---|---|---|
| CAS Number | 2260-50-6 | Molecular Weight | 273.112 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H16INO2 | Melting Point | 161-164 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 2-Acetoxy-N,N,N-trimethylethanaminium iodideAcetylcholine iodide is a common neurotransmitter found in the central and peripheral nerve system[1]. |
| Name | 2-acetyloxyethyl(trimethyl)azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Description | Acetylcholine iodide is a common neurotransmitter found in the central and peripheral nerve system[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 161-164 °C |
|---|---|
| Molecular Formula | C7H16INO2 |
| Molecular Weight | 273.112 |
| Exact Mass | 273.022552 |
| PSA | 26.30000 |
| InChIKey | SMBBQHHYSLHDHF-UHFFFAOYSA-M |
| SMILES | CC(=O)OCC[N+](C)(C)C.[I-] |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | KH3300000 |
| HS Code | 2923900090 |
|
~%
2-Acetoxy-N,N,N... CAS#:2260-50-6 |
| Literature: Zhurnal Obshchei Khimii, , vol. 28, p. 1332; engl. Ausg. S. 1390 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Tibolone prevents oxidation and ameliorates cholinergic deficit induced by ozone exposure in the male rat hippocampus.
Neurochem. Res. 39(9) , 1776-86, (2014) Oxidative stress is related to the development of central nervous system diseases involving memory processes. Cholinergic system and memory processes are disrupted by ozone exposure. In rats, ozone in... |
|
|
Chloroform extract of underground parts of Ferula heuffelii: secondary metabolites and spasmolytic activity.
Chem. Biodivers. 11(9) , 1417-27, (2014) Plants from the genus Ferula L. (Apiaceae) were used for various purposes in traditional medicine of different nations throughout the history. Ferula heuffelii Griseb. ex Heuffel is a perennial specie... |
|
|
Protective Effect of Lavandula stoechas and Rosmarinus officinalis essential oils against reproductive damage and oxidative stress in alloxan-induced diabetic rats.
J. Med. Food 18(2) , 241-9, (2015) The authors aimed in the present study to assess the protective effect of Rosmarinus officinalis essential oils (ROEO) and Lavandula stoechas essential oils (LSEO) against reproductive damage and oxid... |
| [14C]-Acetylcholine iodide |
| acetylthiocholine iodide |
| (2-Acetoxyethyl)trimethylammonium iodide |
| Acetylcolina [Italian] |
| acetylcholin iodide |
| Choline,iodide,acetate (ester) |
| Acetylcholine iodide |
| EINECS 218-862-3 |
| Ethanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, iodide (1:1) |
| MFCD00011815 |
| 2-Acetoxy-N,N,N-trimethylethanaminium iodide |
| [2H]-Acetylcholine iodide |
| 2-(ACETYLOXY)-N,N,N-TRIMETHYLETHANAMINIUM IODIDE |
| Choline,acetyl-,iodide (6CI,7CI) |
| Acetylcholinium iodide |