4,4'-Oxybisbenzoic acid structure
|
Common Name | 4,4'-Oxybisbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2215-89-6 | Molecular Weight | 258.226 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 473.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O5 | Melting Point | 329 °C | |
| MSDS | USA | Flash Point | 184.1±18.1 °C | |
| Name | 4-(4-carboxyphenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.7±30.0 °C at 760 mmHg |
| Melting Point | 329 °C |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.226 |
| Flash Point | 184.1±18.1 °C |
| Exact Mass | 258.052826 |
| PSA | 83.83000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | WVDRSXGPQWNUBN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Oc2ccc(C(=O)O)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 218-683-0 |
| Benzoic acid,4,4'-oxybis |
| Benzoic acid, 4,4'-oxybis- |
| 4,4'-Oxybis(benzoic acid) |
| 4,4'-oxydibenzoic acid |
| 4,4'-Oxybisbenzoic Acid |
| 4,4'-Oxydibenzoic acid |
| 4,4’-Oxybis(benzoic acid) |
| 4,4′-oxybis(benzoic acid) |
| 4,4'-Dicarboxydiphenyl Ether |
| MFCD00013988 |
| diphenylether-4,4'-dicarboxylic acid |
| 4,4-Oxobisbenzoic Acid |
| Diphenyl Ether 4,4'-Dicarboxylic Acid |
| 4-(4-carboxyphenoxy)benzoic acid |