Lygosporin A structure
|
Common Name | Lygosporin A | ||
|---|---|---|---|---|
| CAS Number | 22144-77-0 | Molecular Weight | 507.618 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 712.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C30H37NO6 | Melting Point | 255-260ºC | |
| MSDS | Chinese USA | Flash Point | 384.5±32.9 °C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
Use of Lygosporin ACytochalasin D (Zygosporin A; NSC 209835) is a potent and cell-permeable inhibitor of actin polymerization derived from fungus, inhibits the G-actin–cofilin interaction by binding to G-actin. Cytochalasin D (Zygosporin A; NSC 209835) also inhibits the binding of cofilin to F-actin and decreases the rate of both actin polymerization and depolymerization in living cells[1][2][3]. |
| Name | cytochalasin D |
|---|---|
| Synonym | More Synonyms |
| Description | Cytochalasin D (Zygosporin A; NSC 209835) is a potent and cell-permeable inhibitor of actin polymerization derived from fungus, inhibits the G-actin–cofilin interaction by binding to G-actin. Cytochalasin D (Zygosporin A; NSC 209835) also inhibits the binding of cofilin to F-actin and decreases the rate of both actin polymerization and depolymerization in living cells[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
G-actin[1] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 712.1±60.0 °C at 760 mmHg |
| Melting Point | 255-260ºC |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.618 |
| Flash Point | 384.5±32.9 °C |
| Exact Mass | 507.262085 |
| PSA | 112.93000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | SDZRWUKZFQQKKV-IBUWGYDRSA-N |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(OC(C)=O)C=CC(C)(O)C(=O)C(C)CC=CC3C1O |
| Storage condition | −20°C |
| Water Solubility | DMSO: soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H361 |
| Precautionary Statements | P264-P281-P301 + P310 |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
| Hazard Codes | T |
| Risk Phrases | R25 |
| Safety Phrases | S45-S36-S37 |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | GZ4850000 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
|
Inhibition of autophagy suppresses sertraline-mediated primary ciliogenesis in retinal pigment epithelium cells.
PLoS ONE 10(2) , e0118190, (2015) Primary cilia are conserved cellular organelles that regulate diverse signaling pathways. Autophagy is a complex process of cellular degradation and recycling of cytoplasmic proteins and organelles, a... |
|
|
A new genetically encoded single-chain biosensor for Cdc42 based on FRET, useful for live-cell imaging.
PLoS ONE 9(5) , e96469, (2014) Cdc42 is critical in a myriad of cellular morphogenic processes, requiring precisely regulated activation dynamics to affect specific cellular events. To facilitate direct observations of Cdc42 activa... |
|
|
Cargoing P-gp inhibitors via nanoparticle sensitizes tumor cells against doxorubicin.
Int. J. Pharm. 478(2) , 745-52, (2015) Inhibitors against multidrug resistance (MDR) efflux transporters have failed in most clinical settings due to unfavorable pharmacokinetic interactions with co-administered anti-cancer drug and their ... |
| Methylmalonate |
| CYTOCHALACIND |
| Zygosporin A |
| Lygosporin A |
| CYTOCHALICIND |
| MFCD00077706 |
| 19-trien-17-one |
| Cytochalasin D,Zygosporin A |
| CYTOCHALASIN D |
| 1H-Cycloundec[d]isoindole-1,11(2H)-dione, 15-(acetyloxy)-3,3a,4,5,6,6a,9,10,12,15-decahydro-6,12-dihydroxy-4,10,12-trimethyl-5-methylene-3-(phenylmethyl)-, (7Z,13E)- |
| (7Z,13E)-3-benzyl-6,12-dihydroxy-4,10,12-trimethyl-5-methylidene-1,11-dioxo-2,3,3a,4,5,6,6a,9,10,11,12,15-dodecahydro-1H-cycloundeca[d]isoindol-15-yl acetate |
| Cytohalasin d |
| EINECS 244-804-1 |
| (7Z,13E)-3-Benzyl-6,12-dihydroxy-4,10,12-trimethyl-5-methylene-1,11-dioxo-2,3,3a,4,5,6,6a,9,10,11,12,15-dodecahydro-1H-cycloundeca[d]isoindol-15-yl acetate |
| 7,18-Dihydroxy-10-phenyl-5,16,18-trimethyl-(11)cytochalas-21-acetoxy-6(12),13,19-trien-17-one |
| 13C-Cytochalasin D |