Fmoc-Ala-Glu-Asn-Lys-NH2 structure
|
Common Name | Fmoc-Ala-Glu-Asn-Lys-NH2 | ||
|---|---|---|---|---|
| CAS Number | 220701-06-4 | Molecular Weight | 681.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H43N7O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Ala-Glu-Asn-Lys-NH2Fmoc-Ala-Glu-Asn-Lys-NH2 is a selective asparagine endopeptidase (AEP) inhibitor peptide and suppresses amyloid precursor protein (APP) cleavage. AEP, a pH-controlled cysteine proteinase, is activated during ageing and mediates APP proteolytic processing[1]. |
| Name | Fmoc-Ala-Glu-Asn-Lys-NH2 |
|---|
| Description | Fmoc-Ala-Glu-Asn-Lys-NH2 is a selective asparagine endopeptidase (AEP) inhibitor peptide and suppresses amyloid precursor protein (APP) cleavage. AEP, a pH-controlled cysteine proteinase, is activated during ageing and mediates APP proteolytic processing[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Fmoc-Ala-Glu-Asn-Lys-NH2 antagonizes APP processing by AEP, whereas other small molecular inhibitors and inactive peptide AEQK were without effect[1]. |
| References |
| Molecular Formula | C33H43N7O9 |
|---|---|
| Molecular Weight | 681.74 |
| InChIKey | SAWVPDQXSCHRKB-UZTPZCRESA-N |
| SMILES | CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(CCC(=O)O)C(=O)NC(CC(N)=O)C(=O)NC(CCCCN)C(N)=O |