GSK-3484862 structure
|
Common Name | GSK-3484862 | ||
|---|---|---|---|---|
| CAS Number | 2170136-65-7 | Molecular Weight | 365.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GSK-3484862GSK-3484862 is a non-covalent inhibitor for Dnmt1. GSK-3484862 induces DNA hypomethylation to against cancer[1]. |
| Name | GSK-3484862 |
|---|
| Description | GSK-3484862 is a non-covalent inhibitor for Dnmt1. GSK-3484862 induces DNA hypomethylation to against cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
DNMT1 |
| References |
| Molecular Formula | C19H19N5OS |
|---|---|
| Molecular Weight | 365.45 |
| InChIKey | KIEQQZZDWUNUQK-MRXNPFEDSA-N |
| SMILES | CCc1c(C#N)c(SC(C(N)=O)c2ccccc2)nc(N(C)C)c1C#N |