USP7-IN-5
Modify Date: 2025-09-11 12:05:36
USP7-IN-5 structure
|
Common Name | USP7-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 2166599-74-0 | Molecular Weight | 641.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H43N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of USP7-IN-5USP7-IN-5 is a potent ubiquitin specific protease 7 (USP7) inhibitor extracted from patent WO2017212012A1, example 40, has an IC50 of 49.9 nM[1]. |
| Name | USP7-IN-5 |
|---|
| Description | USP7-IN-5 is a potent ubiquitin specific protease 7 (USP7) inhibitor extracted from patent WO2017212012A1, example 40, has an IC50 of 49.9 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 49.9 nM (USP7)[1] |
| In Vitro | USP7-IN-5 (example 40) shows cytotoxicity to MM1S cells, with an IC50 31.5 nM[1]. |
| References |
| Molecular Formula | C36H43N5O6 |
|---|---|
| Molecular Weight | 641.76 |
| InChIKey | QKYAFWNZSJXZFS-DGPALRBDSA-N |
| SMILES | COc1ccc(-n2ccc3c(=O)n(CC4(O)CCN(C(=O)C5CCN(C(=O)OC(C)(C)C)CC5c5ccccc5)CC4)cnc32)cc1 |