4,6-Dimethoxyindoline-2,3-dione structure
|
Common Name | 4,6-Dimethoxyindoline-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 21544-81-0 | Molecular Weight | 207.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | 300-304°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-Dimethoxy-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 300-304°C |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.183 |
| Exact Mass | 207.053162 |
| PSA | 64.63000 |
| LogP | 0.61 |
| Index of Refraction | 1.567 |
| InChIKey | FAMGTYWNHVETJC-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(OC)c1)C(=O)C(=O)N2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~97%
4,6-Dimethoxyin... CAS#:21544-81-0 |
| Literature: Zhang, Ai Hua; Jiang, Nan; Gu, Wen; Ma, Jing; Wang, Yu Rong; Song, Yong Chun; Tan, Ren Xiang Chemistry - A European Journal, 2010 , vol. 16, # 48 p. 14479 - 14485 |
|
~%
4,6-Dimethoxyin... CAS#:21544-81-0 |
| Literature: US2013/281397 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-dimethoxyisatin |
| 4,6-Dimethoxyindoline-2,3-dione |
| 4,6-dimethoxy-2,3-dioxoindoline |
| 1H-Indole-2,3-dione, 4,6-dimethoxy- |
| 4,6-dimethoxyindole-2,3-dione |
| 4,6-Dimethoxy-1H-indole-2,3-dione |