2-Amino-4,6-dimethoxybenzoic acid structure
|
Common Name | 2-Amino-4,6-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 21577-57-1 | Molecular Weight | 197.188 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 374.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 180.5±27.9 °C | |
| Name | 2-amino-4,6-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.8±42.0 °C at 760 mmHg |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.188 |
| Flash Point | 180.5±27.9 °C |
| Exact Mass | 197.068802 |
| PSA | 81.78000 |
| LogP | 0.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | HZBQKANLOSWJLU-UHFFFAOYSA-N |
| SMILES | COc1cc(N)c(C(=O)O)c(OC)c1 |
| HS Code | 2922509090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-AMINO-4,6-DIMETHOXY-BENZOIC ACID |
| Benzoic acid, 2-amino-4,6-dimethoxy- |
| 2-Amino-4,6-dimethoxybenzoic acid |
| 4,6-dimethoxyanthranilic acid |