2-Amino-4,6-dinitrobenzoic acid
Modify Date: 2025-08-25 11:08:34
2-Amino-4,6-dinitrobenzoic acid structure
|
Common Name | 2-Amino-4,6-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 140380-55-8 | Molecular Weight | 227.13100 | |
| Density | 1.775g/cm3 | Boiling Point | 494.1ºC at 760mmHg | |
| Molecular Formula | C7H5N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | 2-Amino-4,6-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.775g/cm3 |
|---|---|
| Boiling Point | 494.1ºC at 760mmHg |
| Molecular Formula | C7H5N3O6 |
| Molecular Weight | 227.13100 |
| Flash Point | 252.6ºC |
| Exact Mass | 227.01800 |
| PSA | 154.96000 |
| LogP | 2.41100 |
| Vapour Pressure | 1.4E-10mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | OBJZCQXAXGNLGZ-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(=O)O |
| HS Code | 2922499990 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:129-66-8| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2-amino-4,6-dinitro |
| 4,6-dinitroanthranilic acid |
| 6-amino-2,4-dinitrobenzoic acid |
| 4-ADNBA |