1,4,6-trihydroxynaphthalene-2,3-dione
Modify Date: 2025-09-18 13:04:45
1,4,6-trihydroxynaphthalene-2,3-dione structure
|
Common Name | 1,4,6-trihydroxynaphthalene-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 62345-13-5 | Molecular Weight | 206.15200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4,6-trihydroxynaphthalene-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6O5 |
|---|---|
| Molecular Weight | 206.15200 |
| Exact Mass | 206.02200 |
| PSA | 94.83000 |
| InChIKey | KSJXJDQYBZIEGQ-UHFFFAOYSA-N |
| SMILES | O=C1C(O)=C(O)C(=O)c2cc(O)ccc21 |
|
~%
1,4,6-trihydrox... CAS#:62345-13-5 |
| Literature: Garden; Thomson Journal of the Chemical Society, 1957 , p. 2483,2486 |
|
~%
1,4,6-trihydrox... CAS#:62345-13-5 |
| Literature: Weygand; Vogelbach; Zimmermann Chemische Berichte, 1947 , vol. 80, p. 391,398 |
|
~%
1,4,6-trihydrox... CAS#:62345-13-5 |
| Literature: Weygand; Vogelbach; Zimmermann Chemische Berichte, 1947 , vol. 80, p. 391,398 |
| 2,3,6-trihydroxy-[1,4]naphthoquinone |
| 1,4-Naphthalenedione,2,3,6-trihydroxy |
| 2,3,6-Trihydroxy-[1,4]naphthochinon |