1-chloro-2-(methylsulphonyl)-4-nitrobenzene structure
|
Common Name | 1-chloro-2-(methylsulphonyl)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 21081-74-3 | Molecular Weight | 235.64500 | |
| Density | 1.52g/cm3 | Boiling Point | 421.1ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO4S | Melting Point | 171-173 °C | |
| MSDS | N/A | Flash Point | 208.5ºC | |
| Name | 1-chloro-2-methylsulfonyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760 mmHg |
| Melting Point | 171-173 °C |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.64500 |
| Flash Point | 208.5ºC |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.25570 |
| Vapour Pressure | 6.56E-07mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | XYJJSLMPHYYITA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl |
| Hazard Codes | T+ |
|---|
|
~%
1-chloro-2-(met... CAS#:21081-74-3 |
| Literature: Dickey et al. Industrial and Engineering Chemistry, 1953 , vol. 45, p. 1730,1732 Industrial and Engineering Chemistry, 1954 , vol. 46, p. 2213,2218, 2219 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-methylsulphonyl-4-nitrochlorobenzene |
| EINECS 244-200-8 |
| 4-Nitro-2-methylsulfonyl-chlorbenzol |
| 1-chloro-2-methanesulfonyl-4-nitrobenzene |