1-chloro-2-(dibenzylsulfamoyliminomethyl)-4-nitrobenzene structure
|
Common Name | 1-chloro-2-(dibenzylsulfamoyliminomethyl)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 108167-36-8 | Molecular Weight | 443.90300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18ClN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-2-(dibenzylsulfamoyliminomethyl)-4-nitrobenzene |
|---|
| Molecular Formula | C21H18ClN3O4S |
|---|---|
| Molecular Weight | 443.90300 |
| Exact Mass | 443.07100 |
| PSA | 103.94000 |
| LogP | 6.21830 |
| InChIKey | DDGMPSWQMWEJIY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C=NS(=O)(=O)N(Cc2ccccc2)Cc2ccccc2)c1 |
|
~78%
1-chloro-2-(dib... CAS#:108167-36-8 |
| Literature: Davis, Franklin A.; McCauley, John P.; Chattopadhyay, Sankar; Harakal, Mark E.; Towson, James C.; et al. Journal of the American Chemical Society, 1987 , vol. 109, # 11 p. 3370 - 3377 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |