3-[(4,5-diphenyl-1,3-oxazol-2-yl)amino]propan-1-ol
Modify Date: 2025-09-29 06:25:23
![3-[(4,5-diphenyl-1,3-oxazol-2-yl)amino]propan-1-ol Structure](https://image.chemsrc.com/caspic/301/20503-76-8.png)
3-[(4,5-diphenyl-1,3-oxazol-2-yl)amino]propan-1-ol structure
|
Common Name | 3-[(4,5-diphenyl-1,3-oxazol-2-yl)amino]propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 20503-76-8 | Molecular Weight | 294.34800 | |
| Density | 1.196g/cm3 | Boiling Point | 464.9ºC at 760 mmHg | |
| Molecular Formula | C18H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 3-[(4,5-diphenyl-1,3-oxazol-2-yl)amino]propan-1-ol |
|---|
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 464.9ºC at 760 mmHg |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.34800 |
| Flash Point | 235ºC |
| Exact Mass | 294.13700 |
| PSA | 61.52000 |
| LogP | 3.22480 |
| Vapour Pressure | 1.92E-09mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | BVGNTPPDHPKTMW-UHFFFAOYSA-N |
| SMILES | OCCCNc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| HS Code | 2934999090 |
|---|
|
~%
3-[(4,5-dipheny... CAS#:20503-76-8 |
| Literature: Marchetti; Mattalia; Rosnati Journal of medicinal chemistry, 1968 , vol. 11, # 5 p. 1092 - 1093 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |