4-(7-diethylaminocoumarin-3-yl)benzoyl cyanide structure
|
Common Name | 4-(7-diethylaminocoumarin-3-yl)benzoyl cyanide | ||
|---|---|---|---|---|
| CAS Number | 203256-20-6 | Molecular Weight | 346.37900 | |
| Density | 1.259g/cm3 | Boiling Point | 557.154ºC at 760 mmHg | |
| Molecular Formula | C21H18N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 290.756ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[7-(diethylamino)-2-oxochromen-3-yl]benzoyl cyanide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 557.154ºC at 760 mmHg |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.37900 |
| Flash Point | 290.756ºC |
| Exact Mass | 346.13200 |
| PSA | 74.31000 |
| LogP | 4.01248 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | SWWHUDUIQPNVFF-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2cc(-c3ccc(C(=O)C#N)cc3)c(=O)oc2c1 |
|
~85%
4-(7-diethylami... CAS#:203256-20-6 |
| Literature: Takechi, Haruko; Goto, Yasuo; Machida, Minoru Chemical and Pharmaceutical Bulletin, 1998 , vol. 46, # 1 p. 159 - 162 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-(7-Diethylaminocoumarin-3-yl)benzoyl cyanide |
| DACB-CN |