tri-GalNAc-COOH structure
|
Common Name | tri-GalNAc-COOH | ||
|---|---|---|---|---|
| CAS Number | 1953146-81-0 | Molecular Weight | 1735.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C75H134N10O35 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of tri-GalNAc-COOHtri-GalNAc-COOH is an asialoglycoprotein receptor (ASGPR) ligand that can be used for LYsosome TArgeting Chimera (LYTAC) research[1]. |
| Name | tri-GalNAc-COOH |
|---|
| Description | tri-GalNAc-COOH is an asialoglycoprotein receptor (ASGPR) ligand that can be used for LYsosome TArgeting Chimera (LYTAC) research[1]. |
|---|---|
| Related Catalog | |
| In Vitro | tri-GalNAc-COOH is a biotin-free ASGPR ligand, which failes to deliver NA-650 to HepG2, Huh7, or A549 cells[1]. |
| References |
| Molecular Formula | C75H134N10O35 |
|---|---|
| Molecular Weight | 1735.91 |
| InChIKey | SPYOMGAJOYWUJU-JNYSMVCCSA-N |
| SMILES | CC(=O)NC1C(OCCCCC(=O)NCCCNC(=O)CCOCC(COCCC(=O)NCCCNC(=O)CCCCOC2OC(CO)C(O)C(O)C2NC(C)=O)(COCCC(=O)NCCCNC(=O)CCCCOC2OC(CO)C(O)C(O)C2NC(C)=O)NC(=O)CCOCCOCCOCCOCCOCCC(=O)O)OC(CO)C(O)C1O |