Tri-GalNAc(OAc)3 structure
|
Common Name | Tri-GalNAc(OAc)3 | ||
|---|---|---|---|---|
| CAS Number | 1159408-64-6 | Molecular Weight | 1793.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C79H128N10O36 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tri-GalNAc(OAc)3Tri-GalNAc(OAc)3 is a tri-GalNAc ligand that can be used for the synthesis of GalNAc-LYTAC. GalNAc-LYTAC engages the asialoglycoprotein receptor for targeted protein degradation. tri-GalNAc: triantenerrary N-acetylgalactosamine; LYTAC: lysosome-targeting chimera[1]. |
| Name | Tri-GalNAc(OAc)3 |
|---|
| Description | Tri-GalNAc(OAc)3 is a tri-GalNAc ligand that can be used for the synthesis of GalNAc-LYTAC. GalNAc-LYTAC engages the asialoglycoprotein receptor for targeted protein degradation. tri-GalNAc: triantenerrary N-acetylgalactosamine; LYTAC: lysosome-targeting chimera[1]. |
|---|---|
| Related Catalog | |
| Target |
LYTAC[1] |
| References |
| Molecular Formula | C79H128N10O36 |
|---|---|
| Molecular Weight | 1793.91 |
| InChIKey | VGHVGBJYGYFWED-PNPDLPPQSA-N |
| SMILES | CC(=O)NC1C(OCCCCC(=O)NCCCNC(=O)CCOCC(N)(COCCC(=O)NCCCNC(=O)CCCCOC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2NC(C)=O)COCCC(=O)NCCCNC(=O)CCCCOC2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2NC(C)=O)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |