4-Acetylamino-2-(diethylamino)anisole
Modify Date: 2025-08-25 16:44:34
4-Acetylamino-2-(diethylamino)anisole structure
|
Common Name | 4-Acetylamino-2-(diethylamino)anisole | ||
|---|---|---|---|---|
| CAS Number | 19433-93-3 | Molecular Weight | 236.31000 | |
| Density | 1.086 g/cm3 | Boiling Point | 389.5ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O2 | Melting Point | 93-97 °C(lit.) | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | N-[3-(diethylamino)-4-methoxyphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.086 g/cm3 |
|---|---|
| Boiling Point | 389.5ºC at 760 mmHg |
| Melting Point | 93-97 °C(lit.) |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31000 |
| Flash Point | 189.3ºC |
| Exact Mass | 236.15200 |
| PSA | 41.57000 |
| LogP | 2.57280 |
| Vapour Pressure | 2.85E-06mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | BTJCIVXKBILNPY-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc(NC(C)=O)ccc1OC |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~%
4-Acetylamino-2... CAS#:19433-93-3 |
| Literature: Watanabe, Tetsushi; Shiozawa, Tatsushi; Takahashi, Yoshifumi; Takahashi, Tomoyuki; Terao, Yoshiyasu; Nukaya, Haruo; Takamura, Takeji; Sawanishi, Hiroyuki; Ohe, Takeshi; Hirayama, Teruhisa; Wakabayashi, Keiji Mutagenesis, 2002 , vol. 17, # 4 p. 293 - 299 |
|
~%
4-Acetylamino-2... CAS#:19433-93-3 |
| Literature: US2083308 , ; |
|
~%
4-Acetylamino-2... CAS#:19433-93-3 |
| Literature: US2083308 , ; |
![N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(diethylamino)-4-methoxyphenyl]acetamide structure](https://image.chemsrc.com/caspic/360/56548-64-2.png)
CAS#:56548-64-2| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methoxy-5-acetylamino-N,N-diethylaniline |
| EINECS 243-058-4 |
| 2-methoxy-5-acetamido-N,N-diethylaniline |
| 5-acetylamino-2-methoxy-N,N-diethylaniline |
| 3-acetylamino-6-methoxy-N,N-diethylaniline |
| MFCD01075759 |
| 3-(N,N'-Diethyl)Amino-4-Methoxy Acetanilide |
| 2-Animo-4-cresol |
| 3-N,N-Diethylamino-4-methoxyacetanilide |
| 3-N,N-diethyl-4-methoxyacetanilide |