4-Acetylamino-2-(diallylamino)anisole
Modify Date: 2025-08-20 18:30:03
4-Acetylamino-2-(diallylamino)anisole structure
|
Common Name | 4-Acetylamino-2-(diallylamino)anisole | ||
|---|---|---|---|---|
| CAS Number | 51868-45-2 | Molecular Weight | 260.33100 | |
| Density | 1.081g/cm3 | Boiling Point | 416.4ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O2 | Melting Point | 75-78 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 205.6ºC | |
| Name | N-[3-[bis(prop-2-enyl)amino]-4-methoxyphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 416.4ºC at 760 mmHg |
| Melting Point | 75-78 °C(lit.) |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.33100 |
| Flash Point | 205.6ºC |
| Exact Mass | 260.15200 |
| PSA | 41.57000 |
| LogP | 2.90500 |
| Index of Refraction | 1.574 |
| InChIKey | GGUYNLUBFGZIKN-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)c1cc(NC(C)=O)ccc1OC |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~95%
4-Acetylamino-2... CAS#:51868-45-2 |
| Literature: Mutagenesis, , vol. 17, # 4 p. 293 - 299 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(diallylamino)-4-methoxyphenyl]acetamide structure](https://image.chemsrc.com/caspic/199/51868-46-3.png)
CAS#:51868-46-3| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-N,N-diallyl-4-methoxyacetanilide |
| MFCD01075758 |
| 3-(N,N-Diallyl) Amino-4-Methoxyacetanilide |