CDK9-IN-12
Modify Date: 2025-08-26 17:58:08
CDK9-IN-12 structure
|
Common Name | CDK9-IN-12 | ||
|---|---|---|---|---|
| CAS Number | 1942843-54-0 | Molecular Weight | 378.85 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CDK9-IN-12CDK9-IN-12 displays the optimal CDK9 inhibitory activity with an IC50 value of 5.41 nM. |
| Name | CDK9-IN-12 |
|---|
| Description | CDK9-IN-12 displays the optimal CDK9 inhibitory activity with an IC50 value of 5.41 nM. |
|---|---|
| Related Catalog | |
| Target |
CDK9/cyclinT1:5.41 nM (IC50) |
| References |
| Molecular Formula | C21H19ClN4O |
|---|---|
| Molecular Weight | 378.85 |
| InChIKey | SHDGEOLPEYTGCG-FQEVSTJZSA-N |
| SMILES | Cc1[nH]nc2ccc(-c3cc(NC(CO)c4ccccc4)cnc3Cl)cc12 |