Phenol,2,3,4,5,6-pentafluoro-, 1-acetate structure
|
Common Name | Phenol,2,3,4,5,6-pentafluoro-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 19220-93-0 | Molecular Weight | 226.10000 | |
| Density | 1.526 g/cm3 | Boiling Point | 59-60ºC12 mm Hg,187.4ºC at 760 mmHg | |
| Molecular Formula | C8H3F5O2 | Melting Point | 27-30ºC | |
| MSDS | Chinese USA | Flash Point | 70.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Pentafluorophenyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526 g/cm3 |
|---|---|
| Boiling Point | 59-60ºC12 mm Hg,187.4ºC at 760 mmHg |
| Melting Point | 27-30ºC |
| Molecular Formula | C8H3F5O2 |
| Molecular Weight | 226.10000 |
| Flash Point | 70.8ºC |
| Exact Mass | 226.00500 |
| PSA | 26.30000 |
| LogP | 2.30740 |
| Vapour Pressure | 0.63mmHg at 25°C |
| Index of Refraction | 1.421 |
| InChIKey | ZXTVBLZVILLKPM-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2915390090 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| (2,3,4,5,6-pentafluorophenyl) acetate |
| Acetic Acid Pentafluorophenyl Ester |